C18H20OS — CID 118460480
3-ethoxy-7-ethyl-4,6-dimethyldibenzothiophene (PubChem CID 118460480) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 3-ethoxy-7-ethyl-4,6-dimethyldibenzothiophene.
| Compound Name | 3-ethoxy-7-ethyl-4,6-dimethyldibenzothiophene |
|---|---|
| PubChem CID | 118460480 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-ethoxy-7-ethyl-4,6-dimethyldibenzothiophene |
| SMILES | CCOc1ccc2c(sc3c(C)c(CC)ccc32)c1C |
| InChI | InChI=1S/C18H20OS/c1-5-13-7-8-14-15-9-10-16(19-6-2)12(4)18(15)20-17(14)11(13)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | KKLBPEPIHGZJET-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |