C19H18O2S — CID 118460549
3-ethynoxy-4,6-dimethyl-7-propoxydibenzothiophene (PubChem CID 118460549) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-ethynoxy-4,6-dimethyl-7-propoxydibenzothiophene.
| Compound Name | 3-ethynoxy-4,6-dimethyl-7-propoxydibenzothiophene |
|---|---|
| PubChem CID | 118460549 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-ethynoxy-4,6-dimethyl-7-propoxydibenzothiophene |
| SMILES | C#COc1ccc2c(sc3c(C)c(OCCC)ccc32)c1C |
| InChI | InChI=1S/C19H18O2S/c1-5-11-21-17-10-8-15-14-7-9-16(20-6-2)12(3)18(14)22-19(15)13(17)4/h2,7-10H,5,11H2,1,3-4H3 |
| InChIKey | OJQKRNNVOXUUOY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|