C10H12Cl2O — CID 156723250
1,2-dichloro-3-methyl-4-propoxybenzene (PubChem CID 156723250) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 1,2-dichloro-3-methyl-4-propoxybenzene.
| Compound Name | 1,2-dichloro-3-methyl-4-propoxybenzene |
|---|---|
| PubChem CID | 156723250 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1,2-dichloro-3-methyl-4-propoxybenzene |
| SMILES | CCCOc1ccc(Cl)c(Cl)c1C |
| InChI | InChI=1S/C10H12Cl2O/c1-3-6-13-9-5-4-8(11)10(12)7(9)2/h4-5H,3,6H2,1-2H3 |
| InChIKey | PKZCVUYRTHJCHR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |