C11H13Cl3O — CID 101293544
1,2,3-trichloro-4-pentoxybenzene (PubChem CID 101293544) has the molecular formula C11H13Cl3O and a molecular weight of 267.58 g/mol. Its IUPAC name is 1,2,3-trichloro-4-pentoxybenzene.
| Compound Name | 1,2,3-trichloro-4-pentoxybenzene |
|---|---|
| PubChem CID | 101293544 |
| Molecular Formula | C11H13Cl3O |
| Molecular Weight | 267.58 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 1,2,3-trichloro-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl3O/c1-2-3-4-7-15-9-6-5-8(12)10(13)11(9)14/h5-6H,2-4,7H2,1H3 |
| InChIKey | MEOQBXFUMIURKI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|