C17H25Cl3O — CID 518118
1,2,4-trichloro-5-undecoxybenzene (PubChem CID 518118) has the molecular formula C17H25Cl3O and a molecular weight of 351.75 g/mol. Its IUPAC name is 1,2,4-trichloro-5-undecoxybenzene.
| Compound Name | 1,2,4-trichloro-5-undecoxybenzene |
|---|---|
| PubChem CID | 518118 |
| Molecular Formula | C17H25Cl3O |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1,2,4-trichloro-5-undecoxybenzene |
| SMILES | CCCCCCCCCCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H25Cl3O/c1-2-3-4-5-6-7-8-9-10-11-21-17-13-15(19)14(18)12-16(17)20/h12-13H,2-11H2,1H3 |
| InChIKey | PTIIUMSQCMCGLT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|