C14H11BF2O4S — CID 172852469
(7-ethoxy-4,6-difluorodibenzothiophen-3-yl)oxyboronic acid (PubChem CID 172852469) has the molecular formula C14H11BF2O4S and a molecular weight of 324.11 g/mol. Its IUPAC name is (7-ethoxy-4,6-difluorodibenzothiophen-3-yl)oxyboronic acid.
| Compound Name | (7-ethoxy-4,6-difluorodibenzothiophen-3-yl)oxyboronic acid |
|---|---|
| PubChem CID | 172852469 |
| Molecular Formula | C14H11BF2O4S |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (7-ethoxy-4,6-difluorodibenzothiophen-3-yl)oxyboronic acid |
| SMILES | CCOc1ccc2c(sc3c(F)c(OB(O)O)ccc32)c1F |
| InChI | InChI=1S/C14H11BF2O4S/c1-2-20-9-5-3-7-8-4-6-10(21-15(18)19)12(17)14(8)22-13(7)11(9)16/h3-6,18-19H,2H2,1H3 |
| InChIKey | YGEYGLXQIFXDTP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|