C8H9BF2O5 — CID 142634307
[2,3-difluoro-4-(methoxymethoxy)phenoxy]boronic acid (PubChem CID 142634307) has the molecular formula C8H9BF2O5 and a molecular weight of 233.96 g/mol. Its IUPAC name is [2,3-difluoro-4-(methoxymethoxy)phenoxy]boronic acid.
| Compound Name | [2,3-difluoro-4-(methoxymethoxy)phenoxy]boronic acid |
|---|---|
| PubChem CID | 142634307 |
| Molecular Formula | C8H9BF2O5 |
| Molecular Weight | 233.96 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [2,3-difluoro-4-(methoxymethoxy)phenoxy]boronic acid |
| SMILES | COCOc1ccc(OB(O)O)c(F)c1F |
| InChI | InChI=1S/C8H9BF2O5/c1-14-4-15-5-2-3-6(16-9(12)13)8(11)7(5)10/h2-3,12-13H,4H2,1H3 |
| InChIKey | JSVWXFDUWVJGST-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.96 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|