C10H13FO2 — CID 164891583
2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene (PubChem CID 164891583) has the molecular formula C10H13FO2 and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene.
| Compound Name | 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 164891583 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene |
| SMILES | COCOc1c(C)ccc(C)c1F |
| InChI | InChI=1S/C10H13FO2/c1-7-4-5-8(2)10(9(7)11)13-6-12-3/h4-5H,6H2,1-3H3 |
| InChIKey | KYSFRGZXTNUHMW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|