About 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene
2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene (PubChem CID 164891583) has the molecular formula C10H13FO2
and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene |
| PubChem CID | 164891583 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene |
| SMILES | COCOc1c(C)ccc(C)c1F |
| InChI | InChI=1S/C10H13FO2/c1-7-4-5-8(2)10(9(7)11)13-6-12-3/h4-5H,6H2,1-3H3 |
| InChIKey | KYSFRGZXTNUHMW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene?
The IUPAC name of 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene (CID 164891583) is 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene.
What is the SMILES notation for 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene?
The canonical SMILES for 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene is COCOc1c(C)ccc(C)c1F.
What is the InChIKey of 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene?
The InChIKey is KYSFRGZXTNUHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO2/c1-7-4-5-8(2)10(9(7)11)13-6-12-3/h4-5H,6H2,1-3H3.
What are the key properties of 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene?
2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene has a molecular weight of 184.21 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-(methoxymethoxy)-1,4-dimethylbenzene is sourced from PubChem (CID 164891583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).