C11H15FO2 — CID 166160017
1-fluoro-3-(2-methoxyethoxy)-2,4-dimethylbenzene (PubChem CID 166160017) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-fluoro-3-(2-methoxyethoxy)-2,4-dimethylbenzene.
| Compound Name | 1-fluoro-3-(2-methoxyethoxy)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 166160017 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-fluoro-3-(2-methoxyethoxy)-2,4-dimethylbenzene |
| SMILES | COCCOc1c(C)ccc(F)c1C |
| InChI | InChI=1S/C11H15FO2/c1-8-4-5-10(12)9(2)11(8)14-7-6-13-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | MYVUYJWEDHJWGZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|