C16H16F2O2S — CID 159323591
4,6-difluoro-3,7-dimethoxydibenzothiophene;ethane (PubChem CID 159323591) has the molecular formula C16H16F2O2S and a molecular weight of 310.37 g/mol. Its IUPAC name is 4,6-difluoro-3,7-dimethoxydibenzothiophene;ethane.
| Compound Name | 4,6-difluoro-3,7-dimethoxydibenzothiophene;ethane |
|---|---|
| PubChem CID | 159323591 |
| Molecular Formula | C16H16F2O2S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4,6-difluoro-3,7-dimethoxydibenzothiophene;ethane |
| SMILES | CC.COc1ccc2c(sc3c(F)c(OC)ccc32)c1F |
| InChI | InChI=1S/C14H10F2O2S.C2H6/c1-17-9-5-3-7-8-4-6-10(18-2)12(16)14(8)19-13(7)11(9)15;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | LEBQDLOBDPPTJT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |