C14H7F5O3S — CID 134381380
4,6-difluoro-3-methoxy-7-(trifluoromethylperoxy)dibenzothiophene (PubChem CID 134381380) has the molecular formula C14H7F5O3S and a molecular weight of 350.26 g/mol. Its IUPAC name is 4,6-difluoro-3-methoxy-7-(trifluoromethylperoxy)dibenzothiophene.
| Compound Name | 4,6-difluoro-3-methoxy-7-(trifluoromethylperoxy)dibenzothiophene |
|---|---|
| PubChem CID | 134381380 |
| Molecular Formula | C14H7F5O3S |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4,6-difluoro-3-methoxy-7-(trifluoromethylperoxy)dibenzothiophene |
| SMILES | COc1ccc2c(sc3c(F)c(OOC(F)(F)F)ccc32)c1F |
| InChI | InChI=1S/C14H7F5O3S/c1-20-8-4-2-6-7-3-5-9(21-22-14(17,18)19)11(16)13(7)23-12(6)10(8)15/h2-5H,1H3 |
| InChIKey | UNUIVQGQUZAVMK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|