C13H19NOS — CID 83939838
3-(4-ethoxy-2,3-dimethylphenyl)propanethioamide (PubChem CID 83939838) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-(4-ethoxy-2,3-dimethylphenyl)propanethioamide.
| Compound Name | 3-(4-ethoxy-2,3-dimethylphenyl)propanethioamide |
|---|---|
| PubChem CID | 83939838 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-(4-ethoxy-2,3-dimethylphenyl)propanethioamide |
| SMILES | CCOc1ccc(CCC(N)=S)c(C)c1C |
| InChI | InChI=1S/C13H19NOS/c1-4-15-12-7-5-11(6-8-13(14)16)9(2)10(12)3/h5,7H,4,6,8H2,1-3H3,(H2,14,16) |
| InChIKey | IXDLOFHPMAKYGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|