C13H19NO3S — CID 82346489
3,4,5-triethoxybenzenecarbothioamide (PubChem CID 82346489) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3,4,5-triethoxybenzenecarbothioamide.
| Compound Name | 3,4,5-triethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 82346489 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3,4,5-triethoxybenzenecarbothioamide |
| SMILES | CCOc1cc(C(N)=S)cc(OCC)c1OCC |
| InChI | InChI=1S/C13H19NO3S/c1-4-15-10-7-9(13(14)18)8-11(16-5-2)12(10)17-6-3/h7-8H,4-6H2,1-3H3,(H2,14,18) |
| InChIKey | GIJWWGALLROMMO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|