C19H23NO3S — CID 20985963
4-[2-(3,5-dimethylphenoxy)ethoxy]-3-ethoxybenzenecarbothioamide (PubChem CID 20985963) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylphenoxy)ethoxy]-3-ethoxybenzenecarbothioamide.
| Compound Name | 4-[2-(3,5-dimethylphenoxy)ethoxy]-3-ethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 20985963 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-[2-(3,5-dimethylphenoxy)ethoxy]-3-ethoxybenzenecarbothioamide |
| SMILES | CCOc1cc(C(N)=S)ccc1OCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H23NO3S/c1-4-21-18-12-15(19(20)24)5-6-17(18)23-8-7-22-16-10-13(2)9-14(3)11-16/h5-6,9-12H,4,7-8H2,1-3H3,(H2,20,24) |
| InChIKey | FWVLFLYOFCGRNG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|