C14H19NO4S — CID 79623798
3-(4-carbamothioyl-2-ethoxyphenoxy)-2,2-dimethylpropanoic acid (PubChem CID 79623798) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(4-carbamothioyl-2-ethoxyphenoxy)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4-carbamothioyl-2-ethoxyphenoxy)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79623798 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(4-carbamothioyl-2-ethoxyphenoxy)-2,2-dimethylpropanoic acid |
| SMILES | CCOc1cc(C(N)=S)ccc1OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H19NO4S/c1-4-18-11-7-9(12(15)20)5-6-10(11)19-8-14(2,3)13(16)17/h5-7H,4,8H2,1-3H3,(H2,15,20)(H,16,17) |
| InChIKey | ZTGHXJZTOVORSG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|