C23H23NO3S — CID 22681369
3-ethoxy-4-[2-(2-phenylphenoxy)ethoxy]benzenecarbothioamide (PubChem CID 22681369) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-ethoxy-4-[2-(2-phenylphenoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 3-ethoxy-4-[2-(2-phenylphenoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 22681369 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-ethoxy-4-[2-(2-phenylphenoxy)ethoxy]benzenecarbothioamide |
| SMILES | CCOc1cc(C(N)=S)ccc1OCCOc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-2-25-22-16-18(23(24)28)12-13-21(22)27-15-14-26-20-11-7-6-10-19(20)17-8-4-3-5-9-17/h3-13,16H,2,14-15H2,1H3,(H2,24,28) |
| InChIKey | ZQWXKQUGUPIYSZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|