C17H18ClNO3S — CID 20993126
5-chloro-2-[2-(2-ethoxyphenoxy)ethoxy]benzenecarbothioamide (PubChem CID 20993126) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-chloro-2-[2-(2-ethoxyphenoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[2-(2-ethoxyphenoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 20993126 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-chloro-2-[2-(2-ethoxyphenoxy)ethoxy]benzenecarbothioamide |
| SMILES | CCOc1ccccc1OCCOc1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C17H18ClNO3S/c1-2-20-15-5-3-4-6-16(15)22-10-9-21-14-8-7-12(18)11-13(14)17(19)23/h3-8,11H,2,9-10H2,1H3,(H2,19,23) |
| InChIKey | ZLHCVNOGDHIFAH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|