C13H17NO3S — CID 65470204
ethyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)acetate (PubChem CID 65470204) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)acetate.
| Compound Name | ethyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 65470204 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)acetate |
| SMILES | CCOC(=O)COc1c(C)cc(C(N)=S)cc1C |
| InChI | InChI=1S/C13H17NO3S/c1-4-16-11(15)7-17-12-8(2)5-10(13(14)18)6-9(12)3/h5-6H,4,7H2,1-3H3,(H2,14,18) |
| InChIKey | FABXNXXECGQZJE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|