C12H16FNOS — CID 81105439
4-(3-fluoropropoxy)-3,5-dimethylbenzenecarbothioamide (PubChem CID 81105439) has the molecular formula C12H16FNOS and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-(3-fluoropropoxy)-3,5-dimethylbenzenecarbothioamide.
| Compound Name | 4-(3-fluoropropoxy)-3,5-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 81105439 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-(3-fluoropropoxy)-3,5-dimethylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(C)c1OCCCF |
| InChI | InChI=1S/C12H16FNOS/c1-8-6-10(12(14)16)7-9(2)11(8)15-5-3-4-13/h6-7H,3-5H2,1-2H3,(H2,14,16) |
| InChIKey | GTJXCXCTESCROU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|