C14H14BrNOS2 — CID 65471352
4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzenecarbothioamide (PubChem CID 65471352) has the molecular formula C14H14BrNOS2 and a molecular weight of 356.31 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzenecarbothioamide.
| Compound Name | 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 65471352 |
| Molecular Formula | C14H14BrNOS2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methoxy]-3,5-dimethylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(C)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H14BrNOS2/c1-8-3-10(14(16)18)4-9(2)13(8)17-6-12-5-11(15)7-19-12/h3-5,7H,6H2,1-2H3,(H2,16,18) |
| InChIKey | PBGLKHPFFCTAPT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|