C11H13F2NOS — CID 65471348
4-(2,2-difluoroethoxy)-3,5-dimethylbenzenecarbothioamide (PubChem CID 65471348) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-3,5-dimethylbenzenecarbothioamide.
| Compound Name | 4-(2,2-difluoroethoxy)-3,5-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 65471348 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-3,5-dimethylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(C)c1OCC(F)F |
| InChI | InChI=1S/C11H13F2NOS/c1-6-3-8(11(14)16)4-7(2)10(6)15-5-9(12)13/h3-4,9H,5H2,1-2H3,(H2,14,16) |
| InChIKey | NXYAKMZZENECEW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|