C13H14F2O3 — CID 54939528
(E)-3-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]prop-2-enoic acid (PubChem CID 54939528) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is (E)-3-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54939528 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (E)-3-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1OCC(F)F |
| InChI | InChI=1S/C13H14F2O3/c1-8-5-10(3-4-12(16)17)6-9(2)13(8)18-7-11(14)15/h3-6,11H,7H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | XLDDFBPLGDDJCS-ONEGZZNKSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|