C12H9F5O3 — CID 76990592
3-[4-(2,2-difluoroethoxy)-3-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 76990592) has the molecular formula C12H9F5O3 and a molecular weight of 296.19 g/mol. Its IUPAC name is 3-[4-(2,2-difluoroethoxy)-3-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2,2-difluoroethoxy)-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76990592 |
| Molecular Formula | C12H9F5O3 |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-[4-(2,2-difluoroethoxy)-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F5O3/c13-10(14)6-20-9-3-1-7(2-4-11(18)19)5-8(9)12(15,16)17/h1-5,10H,6H2,(H,18,19) |
| InChIKey | SBXUMKWVYLNUFM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|