C14H13F7O4 — CID 144813034
(E)-3-[3,4-bis(difluoromethoxy)-5-(trifluoromethyl)phenyl]prop-2-enoic acid;ethane (PubChem CID 144813034) has the molecular formula C14H13F7O4 and a molecular weight of 378.24 g/mol. Its IUPAC name is (E)-3-[3,4-bis(difluoromethoxy)-5-(trifluoromethyl)phenyl]prop-2-enoic acid;ethane.
| Compound Name | (E)-3-[3,4-bis(difluoromethoxy)-5-(trifluoromethyl)phenyl]prop-2-enoic acid;ethane |
|---|---|
| PubChem CID | 144813034 |
| Molecular Formula | C14H13F7O4 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (E)-3-[3,4-bis(difluoromethoxy)-5-(trifluoromethyl)phenyl]prop-2-enoic acid;ethane |
| SMILES | CC.O=C(O)/C=C/c1cc(OC(F)F)c(OC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7F7O4.C2H6/c13-10(14)22-7-4-5(1-2-8(20)21)3-6(12(17,18)19)9(7)23-11(15)16;1-2/h1-4,10-11H,(H,20,21);1-2H3/b2-1+; |
| InChIKey | JBFYLCUSXKGCFM-TYYBGVCCSA-N |
| XLogP | 5.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|