C13H12F2O5 — CID 118823723
3-[4-[(E)-2-carboxyethenyl]-2-(difluoromethoxy)phenyl]propanoic acid (PubChem CID 118823723) has the molecular formula C13H12F2O5 and a molecular weight of 286.23 g/mol. Its IUPAC name is 3-[4-[(E)-2-carboxyethenyl]-2-(difluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-[(E)-2-carboxyethenyl]-2-(difluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 118823723 |
| Molecular Formula | C13H12F2O5 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-[4-[(E)-2-carboxyethenyl]-2-(difluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CCC(=O)O)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H12F2O5/c14-13(15)20-10-7-8(2-5-11(16)17)1-3-9(10)4-6-12(18)19/h1-3,5,7,13H,4,6H2,(H,16,17)(H,18,19)/b5-2+ |
| InChIKey | FYFYEDDYLOVNCK-GORDUTHDSA-N |
| XLogP | 2.40 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|