C13H17O3PRf — CID 59253577
(E)-3-[3-methoxy-4-(3-phosphanylpropyl)phenyl]prop-2-enoic acid;rutherfordium (PubChem CID 59253577) has the molecular formula C13H17O3PRf and a molecular weight of 519.25 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(3-phosphanylpropyl)phenyl]prop-2-enoic acid;rutherfordium.
| Compound Name | (E)-3-[3-methoxy-4-(3-phosphanylpropyl)phenyl]prop-2-enoic acid;rutherfordium |
|---|---|
| PubChem CID | 59253577 |
| Molecular Formula | C13H17O3PRf |
| Molecular Weight | 519.25 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (E)-3-[3-methoxy-4-(3-phosphanylpropyl)phenyl]prop-2-enoic acid;rutherfordium |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1CCCP.[Rf] |
| InChI | InChI=1S/C13H17O3P.Rf/c1-16-12-9-10(5-7-13(14)15)4-6-11(12)3-2-8-17;/h4-7,9H,2-3,8,17H2,1H3,(H,14,15);/b7-5+; |
| InChIKey | GBCCTRFMIVPONZ-GZOLSCHFSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|