C23H24O8 — CID 89033549
(E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]propoxy]-4-(hydroxymethyl)phenyl]prop-2-enoic acid (PubChem CID 89033549) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]propoxy]-4-(hydroxymethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]propoxy]-4-(hydroxymethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89033549 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]propoxy]-4-(hydroxymethyl)phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1OCCCOc1cc(/C=C/C(=O)O)ccc1CO |
| InChI | InChI=1S/C23H24O8/c1-29-19-8-4-17(6-10-23(27)28)14-21(19)31-12-2-11-30-20-13-16(5-9-22(25)26)3-7-18(20)15-24/h3-10,13-14,24H,2,11-12,15H2,1H3,(H,25,26)(H,27,28)/b9-5+,10-6+ |
| InChIKey | PEKKVQGWIYLVAE-NXZHAISVSA-N |
| XLogP | 3.23 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|