C16H19NO4 — CID 77062949
3-[3-(3-cyano-3-methylbutoxy)-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 77062949) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[3-(3-cyano-3-methylbutoxy)-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(3-cyano-3-methylbutoxy)-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77062949 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[3-(3-cyano-3-methylbutoxy)-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)cc1OCCC(C)(C)C#N |
| InChI | InChI=1S/C16H19NO4/c1-16(2,11-17)8-9-21-14-10-12(5-7-15(18)19)4-6-13(14)20-3/h4-7,10H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | XFRMOVBRKCKWNA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|