C11H5BrF6O2 — CID 134623557
(E)-3-[4-bromo-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 134623557) has the molecular formula C11H5BrF6O2 and a molecular weight of 363.05 g/mol. Its IUPAC name is (E)-3-[4-bromo-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-bromo-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134623557 |
| Molecular Formula | C11H5BrF6O2 |
| Molecular Weight | 363.05 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | (E)-3-[4-bromo-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H5BrF6O2/c12-9-6(10(13,14)15)3-5(1-2-8(19)20)4-7(9)11(16,17)18/h1-4H,(H,19,20)/b2-1+ |
| InChIKey | WEQRHGDVJFCDEK-OWOJBTEDSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|