C10H7BrF3NO2 — CID 118999666
(E)-3-[2-amino-3-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 118999666) has the molecular formula C10H7BrF3NO2 and a molecular weight of 310.07 g/mol. Its IUPAC name is (E)-3-[2-amino-3-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-amino-3-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118999666 |
| Molecular Formula | C10H7BrF3NO2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | (E)-3-[2-amino-3-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | Nc1c(/C=C/C(=O)O)ccc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C10H7BrF3NO2/c11-8-6(10(12,13)14)3-1-5(9(8)15)2-4-7(16)17/h1-4H,15H2,(H,16,17)/b4-2+ |
| InChIKey | HNBKVMBOFINHRO-DUXPYHPUSA-N |
| XLogP | 3.15 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|