C10H6BrF3O3 — CID 167530765
(E)-3-[2-bromo-4-(trifluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 167530765) has the molecular formula C10H6BrF3O3 and a molecular weight of 311.05 g/mol. Its IUPAC name is (E)-3-[2-bromo-4-(trifluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-bromo-4-(trifluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167530765 |
| Molecular Formula | C10H6BrF3O3 |
| Molecular Weight | 311.05 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | (E)-3-[2-bromo-4-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C10H6BrF3O3/c11-8-5-7(17-10(12,13)14)3-1-6(8)2-4-9(15)16/h1-5H,(H,15,16)/b4-2+ |
| InChIKey | REUPMGHJZWTHDT-DUXPYHPUSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|