C13H12ClF3O3 — CID 118819656
(E)-3-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 118819656) has the molecular formula C13H12ClF3O3 and a molecular weight of 308.68 g/mol. Its IUPAC name is (E)-3-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118819656 |
| Molecular Formula | C13H12ClF3O3 |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (E)-3-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(F)(F)F)cc1CCCCl |
| InChI | InChI=1S/C13H12ClF3O3/c14-7-1-2-10-8-11(20-13(15,16)17)5-3-9(10)4-6-12(18)19/h3-6,8H,1-2,7H2,(H,18,19)/b6-4+ |
| InChIKey | UPAYGNPUMQCHGP-GQCTYLIASA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|