C13H13ClF2O3 — CID 118814050
(E)-3-[2-(3-chloropropyl)-4-(difluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 118814050) has the molecular formula C13H13ClF2O3 and a molecular weight of 290.69 g/mol. Its IUPAC name is (E)-3-[2-(3-chloropropyl)-4-(difluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-chloropropyl)-4-(difluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118814050 |
| Molecular Formula | C13H13ClF2O3 |
| Molecular Weight | 290.69 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (E)-3-[2-(3-chloropropyl)-4-(difluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(F)F)cc1CCCCl |
| InChI | InChI=1S/C13H13ClF2O3/c14-7-1-2-10-8-11(19-13(15)16)5-3-9(10)4-6-12(17)18/h3-6,8,13H,1-2,7H2,(H,17,18)/b6-4+ |
| InChIKey | RWZDVSHBOGELOO-GQCTYLIASA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|