C12H12ClF3O4 — CID 134657979
2-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid (PubChem CID 134657979) has the molecular formula C12H12ClF3O4 and a molecular weight of 312.67 g/mol. Its IUPAC name is 2-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657979 |
| Molecular Formula | C12H12ClF3O4 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[2-(3-chloropropyl)-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(OC(F)(F)F)cc1CCCCl |
| InChI | InChI=1S/C12H12ClF3O4/c13-5-1-2-7-6-8(20-12(14,15)16)3-4-9(7)10(17)11(18)19/h3-4,6,10,17H,1-2,5H2,(H,18,19) |
| InChIKey | BYZLDOXQHIPUEW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|