C11H12Cl2O3 — CID 134656362
2-[4-chloro-2-(3-chloropropyl)phenyl]-2-hydroxyacetic acid (PubChem CID 134656362) has the molecular formula C11H12Cl2O3 and a molecular weight of 263.12 g/mol. Its IUPAC name is 2-[4-chloro-2-(3-chloropropyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-chloro-2-(3-chloropropyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134656362 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-[4-chloro-2-(3-chloropropyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(Cl)cc1CCCCl |
| InChI | InChI=1S/C11H12Cl2O3/c12-5-1-2-7-6-8(13)3-4-9(7)10(14)11(15)16/h3-4,6,10,14H,1-2,5H2,(H,15,16) |
| InChIKey | DQXCWLKQTOYEQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|