C12H10ClF3O5 — CID 170837544
2-[2-(1-chloro-2-oxopropyl)-5-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid (PubChem CID 170837544) has the molecular formula C12H10ClF3O5 and a molecular weight of 326.65 g/mol. Its IUPAC name is 2-[2-(1-chloro-2-oxopropyl)-5-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(1-chloro-2-oxopropyl)-5-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 170837544 |
| Molecular Formula | C12H10ClF3O5 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-[2-(1-chloro-2-oxopropyl)-5-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
| SMILES | CC(=O)C(Cl)c1ccc(OC(F)(F)F)cc1C(O)C(=O)O |
| InChI | InChI=1S/C12H10ClF3O5/c1-5(17)9(13)7-3-2-6(21-12(14,15)16)4-8(7)10(18)11(19)20/h2-4,9-10,18H,1H3,(H,19,20) |
| InChIKey | WLYQDGNKSGSVKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|