C13H12ClNO4 — CID 170837514
2-[2-(1-chloro-2-oxopropyl)-5-(cyanomethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 170837514) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-[2-(1-chloro-2-oxopropyl)-5-(cyanomethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(1-chloro-2-oxopropyl)-5-(cyanomethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 170837514 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[2-(1-chloro-2-oxopropyl)-5-(cyanomethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | CC(=O)C(Cl)c1ccc(CC#N)cc1C(O)C(=O)O |
| InChI | InChI=1S/C13H12ClNO4/c1-7(16)11(14)9-3-2-8(4-5-15)6-10(9)12(17)13(18)19/h2-3,6,11-12,17H,4H2,1H3,(H,18,19) |
| InChIKey | PVNCPYOOUQAFEN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|