C16H10F6O4 — CID 134633857
2-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenyl]acetic acid (PubChem CID 134633857) has the molecular formula C16H10F6O4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 2-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134633857 |
| Molecular Formula | C16H10F6O4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10F6O4/c17-15(18,19)12-7-9(3-6-11(12)13(23)14(24)25)8-1-4-10(5-2-8)26-16(20,21)22/h1-7,13,23H,(H,24,25) |
| InChIKey | FGQMEPHEIGIOSI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |