C17H10F6O3 — CID 118834360
(E)-3-[2-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 118834360) has the molecular formula C17H10F6O3 and a molecular weight of 376.25 g/mol. Its IUPAC name is (E)-3-[2-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118834360 |
| Molecular Formula | C17H10F6O3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (E)-3-[2-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(F)(F)F)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F6O3/c18-16(19,20)12-5-1-10(4-8-15(24)25)14(9-12)11-2-6-13(7-3-11)26-17(21,22)23/h1-9H,(H,24,25)/b8-4+ |
| InChIKey | YWCKFWVZRPVFOX-XBXARRHUSA-N |
| XLogP | 5.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|