C16H11F3O3 — CID 70242654
3-[4-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid (PubChem CID 70242654) has the molecular formula C16H11F3O3 and a molecular weight of 308.26 g/mol. Its IUPAC name is 3-[4-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70242654 |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-[4-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H11F3O3/c17-16(18,19)22-14-8-6-13(7-9-14)12-4-1-11(2-5-12)3-10-15(20)21/h1-10H,(H,20,21) |
| InChIKey | RIZCNAJOAVCTED-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|