C12H7F3N2O4 — CID 116629097
(E)-3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 116629097) has the molecular formula C12H7F3N2O4 and a molecular weight of 300.19 g/mol. Its IUPAC name is (E)-3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116629097 |
| Molecular Formula | C12H7F3N2O4 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (E)-3-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(-c2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C12H7F3N2O4/c13-12(14,15)21-8-3-1-7(2-4-8)11-17-16-9(20-11)5-6-10(18)19/h1-6H,(H,18,19)/b6-5+ |
| InChIKey | PUEKDYBARMNFBQ-AATRIKPKSA-N |
| XLogP | 2.73 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|