C11H10N2O4 — CID 81252444
(E)-3-[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81252444) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is (E)-3-[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81252444 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (E)-3-[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(-c2nnc(/C=C/C(=O)O)o2)c(C)o1 |
| InChI | InChI=1S/C11H10N2O4/c1-6-5-8(7(2)16-6)11-13-12-9(17-11)3-4-10(14)15/h3-5H,1-2H3,(H,14,15)/b4-3+ |
| InChIKey | JQMKFXDYEKFFIV-ONEGZZNKSA-N |
| XLogP | 2.04 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|