C9H4Br2N2O3S — CID 107964085
(E)-3-[5-(2,5-dibromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 107964085) has the molecular formula C9H4Br2N2O3S and a molecular weight of 380.02 g/mol. Its IUPAC name is (E)-3-[5-(2,5-dibromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2,5-dibromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107964085 |
| Molecular Formula | C9H4Br2N2O3S |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 377.83 |
| IUPAC Name | (E)-3-[5-(2,5-dibromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(-c2cc(Br)sc2Br)o1 |
| InChI | InChI=1S/C9H4Br2N2O3S/c10-5-3-4(8(11)17-5)9-13-12-6(16-9)1-2-7(14)15/h1-3H,(H,14,15)/b2-1+ |
| InChIKey | OYYJSKYSCIOOHZ-OWOJBTEDSA-N |
| XLogP | 3.42 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|