C11H6FN3O5 — CID 81258164
(E)-3-[5-(5-fluoro-2-nitrophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81258164) has the molecular formula C11H6FN3O5 and a molecular weight of 279.18 g/mol. Its IUPAC name is (E)-3-[5-(5-fluoro-2-nitrophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(5-fluoro-2-nitrophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81258164 |
| Molecular Formula | C11H6FN3O5 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (E)-3-[5-(5-fluoro-2-nitrophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(-c2cc(F)ccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H6FN3O5/c12-6-1-2-8(15(18)19)7(5-6)11-14-13-9(20-11)3-4-10(16)17/h1-5H,(H,16,17)/b4-3+ |
| InChIKey | VKJYIOZHPFJLAD-ONEGZZNKSA-N |
| XLogP | 1.88 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|