C12H9FN2O4 — CID 81284351
(E)-3-[5-(4-fluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81284351) has the molecular formula C12H9FN2O4 and a molecular weight of 264.21 g/mol. Its IUPAC name is (E)-3-[5-(4-fluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(4-fluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81284351 |
| Molecular Formula | C12H9FN2O4 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (E)-3-[5-(4-fluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | COc1cc(-c2nnc(/C=C/C(=O)O)o2)ccc1F |
| InChI | InChI=1S/C12H9FN2O4/c1-18-9-6-7(2-3-8(9)13)12-15-14-10(19-12)4-5-11(16)17/h2-6H,1H3,(H,16,17)/b5-4+ |
| InChIKey | UFBHOYQIVJBORZ-SNAWJCMRSA-N |
| XLogP | 1.98 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|