C14H6Cl2F3N3O2 — CID 2781881
2-(2,6-dichloro-4-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole (PubChem CID 2781881) has the molecular formula C14H6Cl2F3N3O2 and a molecular weight of 376.12 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,6-dichloro-4-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2781881 |
| Molecular Formula | C14H6Cl2F3N3O2 |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 2-(2,6-dichloro-4-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)Oc1ccc(-c2nnc(-c3cc(Cl)nc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C14H6Cl2F3N3O2/c15-10-5-8(6-11(16)20-10)13-22-21-12(23-13)7-1-3-9(4-2-7)24-14(17,18)19/h1-6H |
| InChIKey | YXKCCBADOMXEMI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|