C14H11F3O3 — CID 90906545
(E)-3-methylidene-6-[4-(trifluoromethoxy)phenyl]hex-5-ene-2,4-dione (PubChem CID 90906545) has the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. Its IUPAC name is (E)-3-methylidene-6-[4-(trifluoromethoxy)phenyl]hex-5-ene-2,4-dione.
| Compound Name | (E)-3-methylidene-6-[4-(trifluoromethoxy)phenyl]hex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 90906545 |
| Molecular Formula | C14H11F3O3 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (E)-3-methylidene-6-[4-(trifluoromethoxy)phenyl]hex-5-ene-2,4-dione |
| SMILES | C=C(C(C)=O)C(=O)/C=C/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3O3/c1-9(10(2)18)13(19)8-5-11-3-6-12(7-4-11)20-14(15,16)17/h3-8H,1H2,2H3/b8-5+ |
| InChIKey | ZKFJOJLNRHSISD-VMPITWQZSA-N |
| XLogP | 3.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|