C17H17F3O5 — CID 70290323
3-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]oxypropyl 2-methylprop-2-enoate (PubChem CID 70290323) has the molecular formula C17H17F3O5 and a molecular weight of 358.31 g/mol. Its IUPAC name is 3-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]oxypropyl 2-methylprop-2-enoate.
| Compound Name | 3-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]oxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70290323 |
| Molecular Formula | C17H17F3O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]oxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)/C=C/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3O5/c1-12(2)16(22)24-11-3-10-23-15(21)9-6-13-4-7-14(8-5-13)25-17(18,19)20/h4-9H,1,3,10-11H2,2H3/b9-6+ |
| InChIKey | SPDINZFJIYDGMK-RMKNXTFCSA-N |
| XLogP | 3.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|