C21H25F3O5 — CID 137481787
6-[4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 137481787) has the molecular formula C21H25F3O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 6-[4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137481787 |
| Molecular Formula | C21H25F3O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 6-[4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(/C=C/C(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3O5/c1-16(2)20(26)28-14-6-4-3-5-13-27-18-10-7-17(8-11-18)9-12-19(25)29-15-21(22,23)24/h7-12H,1,3-6,13-15H2,2H3/b12-9+ |
| InChIKey | VXJSFIHWXIXICR-FMIVXFBMSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|