C17H17F3O5 — CID 70290324
5-(2-methylprop-2-enoyloxy)-2-[[4-(trifluoromethoxy)phenyl]methylidene]pentanoic acid (PubChem CID 70290324) has the molecular formula C17H17F3O5 and a molecular weight of 358.31 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyloxy)-2-[[4-(trifluoromethoxy)phenyl]methylidene]pentanoic acid.
| Compound Name | 5-(2-methylprop-2-enoyloxy)-2-[[4-(trifluoromethoxy)phenyl]methylidene]pentanoic acid |
|---|---|
| PubChem CID | 70290324 |
| Molecular Formula | C17H17F3O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-(2-methylprop-2-enoyloxy)-2-[[4-(trifluoromethoxy)phenyl]methylidene]pentanoic acid |
| SMILES | C=C(C)C(=O)OCCCC(=Cc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C17H17F3O5/c1-11(2)16(23)24-9-3-4-13(15(21)22)10-12-5-7-14(8-6-12)25-17(18,19)20/h5-8,10H,1,3-4,9H2,2H3,(H,21,22) |
| InChIKey | WXYMMNCIXOCVRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|